C22H21N5O2S — CID 55981133
N-cyclopropyl-4-[(E)-3-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]anilino]-3-oxoprop-1-enyl]benzamide (PubChem CID 55981133) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]anilino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]anilino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55981133 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]anilino]-3-oxoprop-1-enyl]benzamide |
| SMILES | Cn1cnnc1Sc1ccc(NC(=O)/C=C/c2ccc(C(=O)NC3CC3)cc2)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-27-14-23-26-22(27)30-19-11-9-17(10-12-19)24-20(28)13-4-15-2-5-16(6-3-15)21(29)25-18-7-8-18/h2-6,9-14,18H,7-8H2,1H3,(H,24,28)(H,25,29)/b13-4+ |
| InChIKey | FMXXPFOZDMVELH-YIXHJXPBSA-N |
| XLogP | 3.51 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|