C23H22N6O2 — CID 46423867
N-cyclopropyl-4-[(E)-3-[4-(1-cyclopropyltetrazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide (PubChem CID 46423867) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[4-(1-cyclopropyltetrazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[4-(1-cyclopropyltetrazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 46423867 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[4-(1-cyclopropyltetrazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NC2CC2)cc1)Nc1ccc(-c2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C23H22N6O2/c30-21(14-3-15-1-4-17(5-2-15)23(31)25-19-10-11-19)24-18-8-6-16(7-9-18)22-26-27-28-29(22)20-12-13-20/h1-9,14,19-20H,10-13H2,(H,24,30)(H,25,31)/b14-3+ |
| InChIKey | IVDSRIYEXPGCKE-LZWSPWQCSA-N |
| XLogP | 3.22 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|