C20H21N7O2 — CID 55698362
N-[2-[[4-(1-cyclopropyltetrazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide (PubChem CID 55698362) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is N-[2-[[4-(1-cyclopropyltetrazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide.
| Compound Name | N-[2-[[4-(1-cyclopropyltetrazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55698362 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[2-[[4-(1-cyclopropyltetrazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1)Nc1ccc(-c2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C20H21N7O2/c28-19(15-4-2-1-3-5-15)21-12-13-22-20(29)23-16-8-6-14(7-9-16)18-24-25-26-27(18)17-10-11-17/h1-9,17H,10-13H2,(H,21,28)(H2,22,23,29) |
| InChIKey | BJFMWGACIOYTOD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|