C21H19ClN8O — CID 166231140
1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[4-(1-cyclopropyltetrazol-5-yl)phenyl]urea (PubChem CID 166231140) has the molecular formula C21H19ClN8O and a molecular weight of 434.89 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[4-(1-cyclopropyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[4-(1-cyclopropyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 166231140 |
| Molecular Formula | C21H19ClN8O |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[4-(1-cyclopropyltetrazol-5-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2nnnn2C2CC2)cc1)Nc1cnn(Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H19ClN8O/c22-16-5-1-14(2-6-16)12-29-13-18(11-23-29)25-21(31)24-17-7-3-15(4-8-17)20-26-27-28-30(20)19-9-10-19/h1-8,11,13,19H,9-10,12H2,(H2,24,25,31) |
| InChIKey | QZYIUTNUXPQBLI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |