C17H21ClN4O2 — CID 111976450
1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea (PubChem CID 111976450) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 111976450 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea |
| SMILES | CC(CO)(NC(=O)Nc1cnn(Cc2ccc(Cl)cc2)c1)C1CC1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-17(11-23,13-4-5-13)21-16(24)20-15-8-19-22(10-15)9-12-2-6-14(18)7-3-12/h2-3,6-8,10,13,23H,4-5,9,11H2,1H3,(H2,20,21,24) |
| InChIKey | BOFJICICMULAJG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |