C17H19ClN4O2 — CID 71864249
1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea (PubChem CID 71864249) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
|---|---|
| PubChem CID | 71864249 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]urea |
| SMILES | O=C(Nc1cnn(Cc2ccc(Cl)cc2)c1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-14-4-1-12(2-5-14)9-22-10-16(8-19-22)21-17(24)20-15-6-3-13(7-15)11-23/h1-6,8,10,13,15,23H,7,9,11H2,(H2,20,21,24)/t13-,15+/m0/s1 |
| InChIKey | DKBURSOGXJDXGQ-DZGCQCFKSA-N |
| XLogP | 2.64 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|