C17H13ClF2N4O — CID 25237620
1-(3-chloro-4-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]urea (PubChem CID 25237620) has the molecular formula C17H13ClF2N4O and a molecular weight of 362.77 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 25237620 |
| Molecular Formula | C17H13ClF2N4O |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]urea |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)Nc1cnn(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H13ClF2N4O/c18-15-7-13(5-6-16(15)20)22-17(25)23-14-8-21-24(10-14)9-11-1-3-12(19)4-2-11/h1-8,10H,9H2,(H2,22,23,25) |
| InChIKey | HDUICGBUZQEIDT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |