C21H31N7O — CID 51124917
1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]urea (PubChem CID 51124917) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is 1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 51124917 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]urea |
| SMILES | CC1CCCN(C(C)(C)CNC(=O)Nc2ccc(-c3nnnn3C3CC3)cc2)C1 |
| InChI | InChI=1S/C21H31N7O/c1-15-5-4-12-27(13-15)21(2,3)14-22-20(29)23-17-8-6-16(7-9-17)19-24-25-26-28(19)18-10-11-18/h6-9,15,18H,4-5,10-14H2,1-3H3,(H2,22,23,29) |
| InChIKey | ATELXTBDEMIUJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |