C19H26N6O — CID 55565410
2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-(4-methylcyclohexyl)acetamide (PubChem CID 55565410) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 55565410 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)CNc2ccc(-c3nnnn3C3CC3)cc2)CC1 |
| InChI | InChI=1S/C19H26N6O/c1-13-2-6-16(7-3-13)21-18(26)12-20-15-8-4-14(5-9-15)19-22-23-24-25(19)17-10-11-17/h4-5,8-9,13,16-17,20H,2-3,6-7,10-12H2,1H3,(H,21,26) |
| InChIKey | MBKVGLFKBZPMDI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |