C19H18F2N6O2 — CID 37228950
2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 37228950) has the molecular formula C19H18F2N6O2 and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 37228950 |
| Molecular Formula | C19H18F2N6O2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[4-(1-cyclopropyltetrazol-5-yl)anilino]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CNc1ccc(-c2nnnn2C2CC2)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H18F2N6O2/c20-19(21)29-16-9-5-14(6-10-16)23-17(28)11-22-13-3-1-12(2-4-13)18-24-25-26-27(18)15-7-8-15/h1-6,9-10,15,19,22H,7-8,11H2,(H,23,28) |
| InChIKey | ZFEWKTYLPQCGKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |