C24H23N7O2 — CID 55702071
1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]urea (PubChem CID 55702071) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]urea.
| Compound Name | 1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55702071 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(OCc2ccccn2)c1)Nc1ccc(-c2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C24H23N7O2/c32-24(26-15-17-4-3-6-22(14-17)33-16-20-5-1-2-13-25-20)27-19-9-7-18(8-10-19)23-28-29-30-31(23)21-11-12-21/h1-10,13-14,21H,11-12,15-16H2,(H2,26,27,32) |
| InChIKey | NTAFUZBXAKTUMG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |