C24H16Cl4N2O2 — CID 4675079
3-(3,4-dichlorophenyl)-N-[3-[3-(3,4-dichlorophenyl)prop-2-enoylamino]phenyl]prop-2-enamide (PubChem CID 4675079) has the molecular formula C24H16Cl4N2O2 and a molecular weight of 506.22 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[3-[3-(3,4-dichlorophenyl)prop-2-enoylamino]phenyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[3-[3-(3,4-dichlorophenyl)prop-2-enoylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4675079 |
| Molecular Formula | C24H16Cl4N2O2 |
| Molecular Weight | 506.22 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[3-[3-(3,4-dichlorophenyl)prop-2-enoylamino]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)Nc1cccc(NC(=O)C=Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C24H16Cl4N2O2/c25-19-8-4-15(12-21(19)27)6-10-23(31)29-17-2-1-3-18(14-17)30-24(32)11-7-16-5-9-20(26)22(28)13-16/h1-14H,(H,29,31)(H,30,32) |
| InChIKey | FFTQGZGDIPUJJW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.22 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|