C18H16Cl2N2O2 — CID 29331413
3-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-N,N-dimethylbenzamide (PubChem CID 29331413) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 3-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 29331413 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)/C=C/c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-22(2)18(24)13-4-3-5-14(11-13)21-17(23)9-7-12-6-8-15(19)16(20)10-12/h3-11H,1-2H3,(H,21,23)/b9-7+ |
| InChIKey | LJFVMVJXDNEGKR-VQHVLOKHSA-N |
| XLogP | 4.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|