C21H18Cl2N4O — CID 108768470
(E)-3-(3,4-dichlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]prop-2-enamide (PubChem CID 108768470) has the molecular formula C21H18Cl2N4O and a molecular weight of 413.31 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108768470 |
| Molecular Formula | C21H18Cl2N4O |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]prop-2-enamide |
| SMILES | Cc1cc(C)nc(Nc2cccc(NC(=O)/C=C/c3ccc(Cl)c(Cl)c3)c2)n1 |
| InChI | InChI=1S/C21H18Cl2N4O/c1-13-10-14(2)25-21(24-13)27-17-5-3-4-16(12-17)26-20(28)9-7-15-6-8-18(22)19(23)11-15/h3-12H,1-2H3,(H,26,28)(H,24,25,27)/b9-7+ |
| InChIKey | SSTSXDFVWOVEIN-VQHVLOKHSA-N |
| XLogP | 5.80 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|