C15H6Cl2F5NO — CID 2932282
3-(3,4-dichlorophenyl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide (PubChem CID 2932282) has the molecular formula C15H6Cl2F5NO and a molecular weight of 382.12 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2932282 |
| Molecular Formula | C15H6Cl2F5NO |
| Molecular Weight | 382.12 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H6Cl2F5NO/c16-7-3-1-6(5-8(7)17)2-4-9(24)23-15-13(21)11(19)10(18)12(20)14(15)22/h1-5H,(H,23,24) |
| InChIKey | FPUOLHVGNVOHHI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|