C16H15Cl2N2O+ — CID 4746135
3-(3,4-dichlorophenyl)-N-(4,6-dimethylpyridin-1-ium-2-yl)prop-2-enamide (PubChem CID 4746135) has the molecular formula C16H15Cl2N2O+ and a molecular weight of 322.22 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-(4,6-dimethylpyridin-1-ium-2-yl)prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-(4,6-dimethylpyridin-1-ium-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4746135 |
| Molecular Formula | C16H15Cl2N2O+ |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-(4,6-dimethylpyridin-1-ium-2-yl)prop-2-enamide |
| SMILES | Cc1cc(C)[nH+]c(NC(=O)C=Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-10-7-11(2)19-15(8-10)20-16(21)6-4-12-3-5-13(17)14(18)9-12/h3-9H,1-2H3,(H,19,20,21)/p+1 |
| InChIKey | FTAMBCPAMSLSJN-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 43.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|