C18H17Cl2NO — CID 3605032
3-(3,4-dichlorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide (PubChem CID 3605032) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3605032 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
| SMILES | CCc1cccc(C)c1NC(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO/c1-3-14-6-4-5-12(2)18(14)21-17(22)10-8-13-7-9-15(19)16(20)11-13/h4-11H,3H2,1-2H3,(H,21,22) |
| InChIKey | SSELUTIJZVNNOZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|