C18H17ClFNO — CID 8761699
(E)-3-(3-chloro-4-fluorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide (PubChem CID 8761699) has the molecular formula C18H17ClFNO and a molecular weight of 317.79 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-fluorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-fluorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8761699 |
| Molecular Formula | C18H17ClFNO |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (E)-3-(3-chloro-4-fluorophenyl)-N-(2-ethyl-6-methylphenyl)prop-2-enamide |
| SMILES | CCc1cccc(C)c1NC(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClFNO/c1-3-14-6-4-5-12(2)18(14)21-17(22)10-8-13-7-9-16(20)15(19)11-13/h4-11H,3H2,1-2H3,(H,21,22)/b10-8+ |
| InChIKey | QCRCCJVCMKVOQK-CSKARUKUSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|