C19H21NO — CID 3643097
N-(2-ethyl-6-methylphenyl)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 3643097) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3643097 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | CCc1cccc(C)c1NC(=O)C=Cc1ccc(C)cc1 |
| InChI | InChI=1S/C19H21NO/c1-4-17-7-5-6-15(3)19(17)20-18(21)13-12-16-10-8-14(2)9-11-16/h5-13H,4H2,1-3H3,(H,20,21) |
| InChIKey | UUKQCQULFTXZRL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|