C16H8F5NO3 — CID 2268652
(E)-3-(1,3-benzodioxol-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide (PubChem CID 2268652) has the molecular formula C16H8F5NO3 and a molecular weight of 357.23 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2268652 |
| Molecular Formula | C16H8F5NO3 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H8F5NO3/c17-11-12(18)14(20)16(15(21)13(11)19)22-10(23)4-2-7-1-3-8-9(5-7)25-6-24-8/h1-5H,6H2,(H,22,23)/b4-2+ |
| InChIKey | CZJJHGVPMPCGMC-DUXPYHPUSA-N |
| XLogP | 3.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|