C23H19FN2O2S — CID 51482085
(E)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide (PubChem CID 51482085) has the molecular formula C23H19FN2O2S and a molecular weight of 406.48 g/mol. Its IUPAC name is (E)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 51482085 |
| Molecular Formula | C23H19FN2O2S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (E)-N-(1-acetyl-2,3-dihydroindol-5-yl)-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)/C=C/c3ccc(-c4ccc(F)cc4)s3)ccc21 |
| InChI | InChI=1S/C23H19FN2O2S/c1-15(27)26-13-12-17-14-19(6-9-21(17)26)25-23(28)11-8-20-7-10-22(29-20)16-2-4-18(24)5-3-16/h2-11,14H,12-13H2,1H3,(H,25,28)/b11-8+ |
| InChIKey | KGFBNVPLPCTQRT-DHZHZOJOSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|