C22H17FN2O3S — CID 46509280
(E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide (PubChem CID 46509280) has the molecular formula C22H17FN2O3S and a molecular weight of 408.45 g/mol. Its IUPAC name is (E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46509280 |
| Molecular Formula | C22H17FN2O3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)prop-2-enamide |
| SMILES | CC1Oc2ccc(NC(=O)/C=C/c3ccc(-c4ccc(F)cc4)s3)cc2NC1=O |
| InChI | InChI=1S/C22H17FN2O3S/c1-13-22(27)25-18-12-16(6-9-19(18)28-13)24-21(26)11-8-17-7-10-20(29-17)14-2-4-15(23)5-3-14/h2-13H,1H3,(H,24,26)(H,25,27)/b11-8+ |
| InChIKey | VAKXIXGZKDTJHN-DHZHZOJOSA-N |
| XLogP | 4.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|