C10H10N2O4 — CID 115170648
(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)carbamic acid (PubChem CID 115170648) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is (2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)carbamic acid.
| Compound Name | (2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)carbamic acid |
|---|---|
| PubChem CID | 115170648 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)carbamic acid |
| SMILES | CC1Oc2ccc(NC(=O)O)cc2NC1=O |
| InChI | InChI=1S/C10H10N2O4/c1-5-9(13)12-7-4-6(11-10(14)15)2-3-8(7)16-5/h2-5,11H,1H3,(H,12,13)(H,14,15) |
| InChIKey | WPYMTCYOGPTATN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |