C16H15N3O3 — CID 41291616
1-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-phenylurea (PubChem CID 41291616) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-phenylurea.
| Compound Name | 1-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-phenylurea |
|---|---|
| PubChem CID | 41291616 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]-3-phenylurea |
| SMILES | C[C@@H]1Oc2ccc(NC(=O)Nc3ccccc3)cc2NC1=O |
| InChI | InChI=1S/C16H15N3O3/c1-10-15(20)19-13-9-12(7-8-14(13)22-10)18-16(21)17-11-5-3-2-4-6-11/h2-10H,1H3,(H,19,20)(H2,17,18,21)/t10-/m0/s1 |
| InChIKey | LYINQNDEXUONJF-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |