C15H19N3O3 — CID 110774624
1-cyclopentyl-3-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea (PubChem CID 110774624) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea.
| Compound Name | 1-cyclopentyl-3-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea |
|---|---|
| PubChem CID | 110774624 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-cyclopentyl-3-(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)urea |
| SMILES | CC1Oc2ccc(NC(=O)NC3CCCC3)cc2NC1=O |
| InChI | InChI=1S/C15H19N3O3/c1-9-14(19)18-12-8-11(6-7-13(12)21-9)17-15(20)16-10-4-2-3-5-10/h6-10H,2-5H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | QOMYDBFBRCZFDH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |