C16H21N3O3 — CID 110774632
1-cyclohexyl-3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea (PubChem CID 110774632) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea.
| Compound Name | 1-cyclohexyl-3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea |
|---|---|
| PubChem CID | 110774632 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-cyclohexyl-3-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-7-yl)urea |
| SMILES | O=C1CCOc2ccc(NC(=O)NC3CCCCC3)cc2N1 |
| InChI | InChI=1S/C16H21N3O3/c20-15-8-9-22-14-7-6-12(10-13(14)19-15)18-16(21)17-11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2,(H,19,20)(H2,17,18,21) |
| InChIKey | HGWYYRISQQRLKW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |