C19H14ClF3N2O3 — CID 9146133
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]prop-2-enamide (PubChem CID 9146133) has the molecular formula C19H14ClF3N2O3 and a molecular weight of 410.78 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 9146133 |
| Molecular Formula | C19H14ClF3N2O3 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]prop-2-enamide |
| SMILES | C[C@@H]1Oc2ccc(NC(=O)/C=C/c3ccc(Cl)c(C(F)(F)F)c3)cc2NC1=O |
| InChI | InChI=1S/C19H14ClF3N2O3/c1-10-18(27)25-15-9-12(4-6-16(15)28-10)24-17(26)7-3-11-2-5-14(20)13(8-11)19(21,22)23/h2-10H,1H3,(H,24,26)(H,25,27)/b7-3+/t10-/m0/s1 |
| InChIKey | LGVHDFBSAOFWIQ-HTZNOQTFSA-N |
| XLogP | 4.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|