C18H15ClF3NO3S — CID 46693652
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-ethylsulfonylphenyl)prop-2-enamide (PubChem CID 46693652) has the molecular formula C18H15ClF3NO3S and a molecular weight of 417.84 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-ethylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-ethylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46693652 |
| Molecular Formula | C18H15ClF3NO3S |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-ethylsulfonylphenyl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)/C=C/c2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H15ClF3NO3S/c1-2-27(25,26)14-7-5-13(6-8-14)23-17(24)10-4-12-3-9-16(19)15(11-12)18(20,21)22/h3-11H,2H2,1H3,(H,23,24)/b10-4+ |
| InChIKey | KOWVYNAJBMIIHY-ONNFQVAWSA-N |
| XLogP | 4.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|