C17H9Cl2F6NO — CID 18863156
(E)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 18863156) has the molecular formula C17H9Cl2F6NO and a molecular weight of 428.16 g/mol. Its IUPAC name is (E)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18863156 |
| Molecular Formula | C17H9Cl2F6NO |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | (E)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl2F6NO/c18-13-5-1-9(7-12(13)17(23,24)25)2-6-15(27)26-10-3-4-11(14(19)8-10)16(20,21)22/h1-8H,(H,26,27)/b6-2+ |
| InChIKey | CWSXQTIUFBEFNM-QHHAFSJGSA-N |
| XLogP | 6.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|