C18H15ClF3NO — CID 18863137
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 18863137) has the molecular formula C18H15ClF3NO and a molecular weight of 353.77 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18863137 |
| Molecular Formula | C18H15ClF3NO |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2ccc(Cl)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C18H15ClF3NO/c1-11-3-6-14(9-12(11)2)23-17(24)8-5-13-4-7-16(19)15(10-13)18(20,21)22/h3-10H,1-2H3,(H,23,24)/b8-5+ |
| InChIKey | FZIOVZRNKKTBDM-VMPITWQZSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|