C12H11ClF3NO2 — CID 78783054
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 78783054) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78783054 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)NCCO |
| InChI | InChI=1S/C12H11ClF3NO2/c13-10-3-1-8(7-9(10)12(14,15)16)2-4-11(19)17-5-6-18/h1-4,7,18H,5-6H2,(H,17,19)/b4-2+ |
| InChIKey | JPHGOWDUAMZCNH-DUXPYHPUSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|