C17H16ClF3N4O — CID 72690415
3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide (PubChem CID 72690415) has the molecular formula C17H16ClF3N4O and a molecular weight of 384.79 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 72690415 |
| Molecular Formula | C17H16ClF3N4O |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(C(F)(F)F)c1)NCCc1nncn1C1CC1 |
| InChI | InChI=1S/C17H16ClF3N4O/c18-14-5-1-11(9-13(14)17(19,20)21)2-6-16(26)22-8-7-15-24-23-10-25(15)12-3-4-12/h1-2,5-6,9-10,12H,3-4,7-8H2,(H,22,26) |
| InChIKey | OPUHNPFZAHRVLX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|