C16H17ClF3NO2 — CID 86932537
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-hydroxycyclohexyl)prop-2-enamide (PubChem CID 86932537) has the molecular formula C16H17ClF3NO2 and a molecular weight of 347.76 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-hydroxycyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-hydroxycyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 86932537 |
| Molecular Formula | C16H17ClF3NO2 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(4-hydroxycyclohexyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C16H17ClF3NO2/c17-14-7-1-10(9-13(14)16(18,19)20)2-8-15(23)21-11-3-5-12(22)6-4-11/h1-2,7-9,11-12,22H,3-6H2,(H,21,23)/b8-2+ |
| InChIKey | NSKXVVMHRLPHGS-KRXBUXKQSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|