C15H16ClF3N2O — CID 9271811
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-piperidin-1-ylprop-2-enamide (PubChem CID 9271811) has the molecular formula C15H16ClF3N2O and a molecular weight of 332.75 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-piperidin-1-ylprop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-piperidin-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 9271811 |
| Molecular Formula | C15H16ClF3N2O |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-piperidin-1-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)NN1CCCCC1 |
| InChI | InChI=1S/C15H16ClF3N2O/c16-13-6-4-11(10-12(13)15(17,18)19)5-7-14(22)20-21-8-2-1-3-9-21/h4-7,10H,1-3,8-9H2,(H,20,22)/b7-5+ |
| InChIKey | CRCHNNMUHHPAGH-FNORWQNLSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|