C15H16ClF3N2O3S — CID 78905953
3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]prop-2-enamide (PubChem CID 78905953) has the molecular formula C15H16ClF3N2O3S and a molecular weight of 396.82 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]prop-2-enamide.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 78905953 |
| Molecular Formula | C15H16ClF3N2O3S |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(C(F)(F)F)c1)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C15H16ClF3N2O3S/c16-13-4-2-11(10-12(13)15(17,18)19)3-5-14(22)20-6-8-21-7-1-9-25(21,23)24/h2-5,10H,1,6-9H2,(H,20,22) |
| InChIKey | KWNNPVXFAXXQNO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|