C16H20ClF3N2O — CID 134016798
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]prop-2-enamide (PubChem CID 134016798) has the molecular formula C16H20ClF3N2O and a molecular weight of 348.80 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134016798 |
| Molecular Formula | C16H20ClF3N2O |
| Molecular Weight | 348.80 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(diethylamino)ethyl]prop-2-enamide |
| SMILES | CCN(CC)CCNC(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20ClF3N2O/c1-3-22(4-2)10-9-21-15(23)8-6-12-5-7-14(17)13(11-12)16(18,19)20/h5-8,11H,3-4,9-10H2,1-2H3,(H,21,23)/b8-6+ |
| InChIKey | QJWDHRDEDBMBGJ-SOFGYWHQSA-N |
| XLogP | 3.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.80 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|