C17H25ClN2O3 — CID 78774034
3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(diethylamino)ethyl]prop-2-enamide (PubChem CID 78774034) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(diethylamino)ethyl]prop-2-enamide.
| Compound Name | 3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(diethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 78774034 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(diethylamino)ethyl]prop-2-enamide |
| SMILES | CCN(CC)CCNC(=O)C=Cc1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H25ClN2O3/c1-5-20(6-2)10-9-19-16(21)8-7-13-11-14(18)17(23-4)15(12-13)22-3/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,19,21) |
| InChIKey | PWKOUMPTHCYCRE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|