C19H20ClN3O5 — CID 9308852
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(4-nitroanilino)ethyl]prop-2-enamide (PubChem CID 9308852) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(4-nitroanilino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(4-nitroanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9308852 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(4-nitroanilino)ethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCNc2ccc([N+](=O)[O-])cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H20ClN3O5/c1-27-17-12-13(11-16(20)19(17)28-2)3-8-18(24)22-10-9-21-14-4-6-15(7-5-14)23(25)26/h3-8,11-12,21H,9-10H2,1-2H3,(H,22,24)/b8-3+ |
| InChIKey | ACZDSIDZFHKUQV-FPYGCLRLSA-N |
| XLogP | 3.51 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|