C22H35NO4 — CID 75211078
N-decyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 75211078) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is N-decyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N-decyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75211078 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | N-decyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCCCCCNC(=O)C=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H35NO4/c1-5-6-7-8-9-10-11-12-15-23-21(24)14-13-18-16-19(25-2)22(27-4)20(17-18)26-3/h13-14,16-17H,5-12,15H2,1-4H3,(H,23,24) |
| InChIKey | XDNARJPETFTOLN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|