C39H48NO7PS — CID 139388717
methanesulfonate;triphenyl-[8-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]octyl]phosphanium (PubChem CID 139388717) has the molecular formula C39H48NO7PS and a molecular weight of 705.85 g/mol. Its IUPAC name is methanesulfonate;triphenyl-[8-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]octyl]phosphanium.
| Compound Name | methanesulfonate;triphenyl-[8-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]octyl]phosphanium |
|---|---|
| PubChem CID | 139388717 |
| Molecular Formula | C39H48NO7PS |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | methanesulfonate;triphenyl-[8-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]octyl]phosphanium |
| SMILES | COc1cc(C=CC(=O)NCCCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C38H44NO4P.CH4O3S/c1-41-35-29-31(30-36(42-2)38(35)43-3)25-26-37(40)39-27-17-6-4-5-7-18-28-44(32-19-11-8-12-20-32,33-21-13-9-14-22-33)34-23-15-10-16-24-34;1-5(2,3)4/h8-16,19-26,29-30H,4-7,17-18,27-28H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | BRGJRVPGJNDEMM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|