C17H24BrNO3 — CID 19201355
(E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-hexylprop-2-enamide (PubChem CID 19201355) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-hexylprop-2-enamide.
| Compound Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-hexylprop-2-enamide |
|---|---|
| PubChem CID | 19201355 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-hexylprop-2-enamide |
| SMILES | CCCCCCNC(=O)/C=C/c1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H24BrNO3/c1-4-5-6-7-10-19-16(20)9-8-13-11-14(18)17(22-3)15(12-13)21-2/h8-9,11-12H,4-7,10H2,1-3H3,(H,19,20)/b9-8+ |
| InChIKey | VQOLWBDGBDEATM-CMDGGOBGSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|