C14H16BrNO5 — CID 102534682
3-[[(E)-3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 102534682) has the molecular formula C14H16BrNO5 and a molecular weight of 358.19 g/mol. Its IUPAC name is 3-[[(E)-3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(E)-3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 102534682 |
| Molecular Formula | C14H16BrNO5 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 3-[[(E)-3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | COc1cc(/C=C/C(=O)NCCC(=O)O)cc(Br)c1OC |
| InChI | InChI=1S/C14H16BrNO5/c1-20-11-8-9(7-10(15)14(11)21-2)3-4-12(17)16-6-5-13(18)19/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)(H,18,19)/b4-3+ |
| InChIKey | VJJLXDYIHNFBEF-ONEGZZNKSA-N |
| XLogP | 2.07 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|