C14H16N2O4 — CID 3488907
N-(cyanomethyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 3488907) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(cyanomethyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3488907 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(cyanomethyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NCC#N)cc(OC)c1OC |
| InChI | InChI=1S/C14H16N2O4/c1-18-11-8-10(4-5-13(17)16-7-6-15)9-12(19-2)14(11)20-3/h4-5,8-9H,7H2,1-3H3,(H,16,17) |
| InChIKey | WHMMXTHGUINEAO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|