C14H16O6 — CID 71350536
methyl 2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enoate (PubChem CID 71350536) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enoate.
| Compound Name | methyl 2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enoate |
|---|---|
| PubChem CID | 71350536 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | methyl 2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enoate |
| SMILES | COC(=O)C(=O)C=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H16O6/c1-17-11-7-9(5-6-10(15)14(16)20-4)8-12(18-2)13(11)19-3/h5-8H,1-4H3 |
| InChIKey | SMBFWLCCKYRMPX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|