C34H36O11 — CID 123132176
4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,7-bis(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 123132176) has the molecular formula C34H36O11 and a molecular weight of 620.65 g/mol. Its IUPAC name is 4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,7-bis(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,7-bis(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 123132176 |
| Molecular Formula | C34H36O11 |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | 4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-1,7-bis(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(C=C(C(=O)C=Cc2cc(OC)c(OC)c(OC)c2)C(=O)C=Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1O |
| InChI | InChI=1S/C34H36O11/c1-38-26-18-22(19-27(39-2)32(26)37)13-23(24(35)11-9-20-14-28(40-3)33(44-7)29(15-20)41-4)25(36)12-10-21-16-30(42-5)34(45-8)31(17-21)43-6/h9-19,37H,1-8H3 |
| InChIKey | URUFXWBHXZLWIR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|