C22H22O9 — CID 174575354
(E)-3-[4-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 174575354) has the molecular formula C22H22O9 and a molecular weight of 430.41 g/mol. Its IUPAC name is (E)-3-[4-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 174575354 |
| Molecular Formula | C22H22O9 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (E)-3-[4-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)Oc2c(OC)cc(/C=C/C(=O)O)cc2OC)cc(OC)c1O |
| InChI | InChI=1S/C22H22O9/c1-27-15-9-14(10-16(28-2)21(15)26)6-8-20(25)31-22-17(29-3)11-13(5-7-19(23)24)12-18(22)30-4/h5-12,26H,1-4H3,(H,23,24)/b7-5+,8-6+ |
| InChIKey | IVVFRNUSAZSFAX-KQQUZDAGSA-N |
| XLogP | 3.14 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|