C13H14O6 — CID 87453578
acetyl 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 87453578) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is acetyl 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | acetyl 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 87453578 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | acetyl 3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OC(C)=O)cc(OC)c1O |
| InChI | InChI=1S/C13H14O6/c1-8(14)19-12(15)5-4-9-6-10(17-2)13(16)11(7-9)18-3/h4-7,16H,1-3H3 |
| InChIKey | MZEYGAVUEYKNGU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|