C28H32ClNO12 — CID 141424017
bis[2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-2-oxoethyl]-dimethylazanium chloride (PubChem CID 141424017) has the molecular formula C28H32ClNO12 and a molecular weight of 610.01 g/mol. Its IUPAC name is bis[2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-2-oxoethyl]-dimethylazanium chloride.
| Compound Name | bis[2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-2-oxoethyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 141424017 |
| Molecular Formula | C28H32ClNO12 |
| Molecular Weight | 610.01 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | bis[2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy-2-oxoethyl]-dimethylazanium chloride |
| SMILES | COc1cc(/C=C/C(=O)OC(=O)C[N+](C)(C)CC(=O)OC(=O)/C=C/c2cc(OC)c(O)c(OC)c2)cc(OC)c1O.[Cl-] |
| InChI | InChI=1S/C28H31NO12.ClH/c1-29(2,15-25(32)40-23(30)9-7-17-11-19(36-3)27(34)20(12-17)37-4)16-26(33)41-24(31)10-8-18-13-21(38-5)28(35)22(14-18)39-6;/h7-14H,15-16H2,1-6H3,(H-,30,31,34,35);1H |
| InChIKey | WNDUXVDQNSSDQC-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.01 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|