C17H26NO4+ — CID 176756027
[(E)-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxohex-5-enyl]-trimethylazanium (PubChem CID 176756027) has the molecular formula C17H26NO4+ and a molecular weight of 308.40 g/mol. Its IUPAC name is [(E)-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxohex-5-enyl]-trimethylazanium.
| Compound Name | [(E)-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxohex-5-enyl]-trimethylazanium |
|---|---|
| PubChem CID | 176756027 |
| Molecular Formula | C17H26NO4+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | [(E)-6-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxohex-5-enyl]-trimethylazanium |
| SMILES | COc1cc(/C=C/C(=O)CCC[N+](C)(C)C)cc(OC)c1O |
| InChI | InChI=1S/C17H25NO4/c1-18(2,3)10-6-7-14(19)9-8-13-11-15(21-4)17(20)16(12-13)22-5/h8-9,11-12H,6-7,10H2,1-5H3/p+1 |
| InChIKey | FJDRAHHAPZIEKU-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|