C16H25ClNO5+ — CID 131668344
2-[3-(4-hydroxy-3,5-dimethoxyphenyl)-1-oxoniumylideneprop-2-enoxy]ethyl-trimethylazanium chloride (PubChem CID 131668344) has the molecular formula C16H25ClNO5+ and a molecular weight of 346.83 g/mol. Its IUPAC name is 2-[3-(4-hydroxy-3,5-dimethoxyphenyl)-1-oxoniumylideneprop-2-enoxy]ethyl-trimethylazanium chloride.
| Compound Name | 2-[3-(4-hydroxy-3,5-dimethoxyphenyl)-1-oxoniumylideneprop-2-enoxy]ethyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 131668344 |
| Molecular Formula | C16H25ClNO5+ |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[3-(4-hydroxy-3,5-dimethoxyphenyl)-1-oxoniumylideneprop-2-enoxy]ethyl-trimethylazanium chloride |
| SMILES | [Cl-].[H]/[O+]=C(\C=Cc1cc(OC)c(O)c(OC)c1)OCC[N+](C)(C)C |
| InChI | InChI=1S/C16H23NO5.ClH/c1-17(2,3)8-9-22-15(18)7-6-12-10-13(20-4)16(19)14(11-12)21-5;/h6-7,10-11H,8-9H2,1-5H3;1H/p+1 |
| InChIKey | XKMPOGBKXGSVAO-UHFFFAOYSA-O |
| XLogP | -1.35 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|